You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573413 |
---|---|
Category | Small Molecules |
Description | ZM223 is a novel non-sulfamide NEDD8 activating enzyme inhibitor that inhibits HCT116 colon cancer cells with an IC50 value of 100 nM. |
CAS Number | [2031177-48-5] |
MW | 502.53 |
SMILES | O=C(C1=CC=C(C(F)(F)F)C=C1)NC2=NC3=CC=C(NC(CSC4=CC=C(N)C=C4)=O)C=C3S2 |
Formula | C23H17F3N4O2S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.67% | |
2031177-48-5 | |
502.53 | |
C23H17F3N4O2S2 |
98% | |
538.99 | |
C23H18ClF3N4O2S2 |