You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1703917 |
---|---|
Category | Small Molecules |
Description | Xanthine amine congener |
CAS Number | 96865-92-8 |
Purity | 99.70% |
MW | 428.48 |
SMILES | C(CC)N1C2=C(NC(=N2)C3=CC=C(OCC(NCCN)=O)C=C3)C(=O)N(CCC)C1=O |
Formula | C21H28N6O4 |
Biological Activity | Xanthine amine congener is an Adenosine receptor antagonist. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
97.85% | |
2459963-12-1 | |
464.95 | |
C21H31Cl3N6O4 |
98.00% | |
1783977-95-6 | |
464.95 | |
C21H29ClN6O4 |
98.00% | |
1962928-23-9 | |
501.41 | |
C21H30Cl2N6O4 |
[96865-92-8] | |
428.5 | |
C21H28N6O4 |