You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573384 |
---|---|
Category | Small Molecules |
Description | WAY-316606, a specific antagonist of SFRP1, functions as an inhibitor of canonical Wnt/β-catenin signalling in the human hair bulb. |
CAS Number | [915759-45-4] |
MW | 448.48 |
SMILES | O=S(C1=CC(S(NC2CCNCC2)(=O)=O)=C(C(F)(F)F)C=C1)(C1=CC=CC=C1)=O |
Formula | C18H19F3N2O4S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
484.94 | |
C18H19F3N2O4S2·HCl |
99.76% | |
915759-45-4 | |
448.48 | |
C18H19F3N2O4S2 |