You have no items in your shopping cart.
Cart summary
WAY 316606 hydrochloride
Catalog Number: orb2283356
| Catalog Number | orb2283356 |
|---|---|
| Category | Small Molecules |
| Description | WAY 316606 hydrochloride is a chemical compound that serves as an inhibitor of sFRP-1 (secreted protein), which functions as an endogenous antagonist of the Wnt (secreted glycoprotein). Its affinity for sFRP-1 is measured through the FP (fluorescence polarization) binding assay, revealing an IC50 (half maximal inhibitory concentration) of 0.5 μM [1]. |
| CAS Number | 1781835-02-6 |
| Purity | 98.00% |
| MW | 484.94 |
| SMILES | S(NC1CCNCC1)(=O)(=O)C2=C(C(F)(F)F)C=CC(S(=O)(=O)C3=CC=CC=C3)=C2.Cl |
| Formula | C18H20ClF3N2O4S2 |
| Biological Activity | WAY 316606 hydrochloride is a chemical compound that serves as an inhibitor of sFRP-1 (secreted protein), which functions as an endogenous antagonist of the Wnt (secreted glycoprotein). Its affinity for sFRP-1 is measured through the FP (fluorescence polarization) binding assay, revealing an IC50 (half maximal inhibitory concentration) of 0.5 μM [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
