You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611517 |
---|---|
Category | Small Molecules |
Description | A potent and selective 5-HT1A receptor antagonist. |
CAS Number | [162760-96-5] |
MW | 422.563 |
SMILES | COC1=C(N2CCN(CCN(C3=NC=CC=C3)C(C3CCCCC3)=O)CC2)C=CC=C1 |
Formula | C25H34N4O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[146714-97-8] | |
531.9459 | |
C25H37CL3N4O2 |
99.68% | |
1092679-51-0 | |
538.64 | |
C29H38N4O6 |
98% | |
634908-75-1 | |
C25H34N4O2.xC4H4O4 |
[634908-75-1] | |
538.6352 | |
C29H38N4O6 |