You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1695294 |
---|---|
Category | Small Molecules |
Description | WAY-100635 maleate |
CAS Number | 634908-75-1 |
Purity | 98% |
SMILES | OC(=O)C=CC(O)=O.COc1ccccc1N1CCN(CCN(C(=O)C2CCCCC2)c2ccccn2)CC1 |
Formula | C25H34N4O2.xC4H4O4 |
Biological Activity | WAY-100635 Maleate is a specific and effective 5-HT receptor antagonist (IC50=0.95 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.68% | |
1092679-51-0 | |
538.64 | |
C29H38N4O6 |
[634908-75-1] | |
538.6352 | |
C29H38N4O6 |