You have no items in your shopping cart.
Cart summary
Vitexin-4''-O-glucoside
Catalog Number: orb1303382
| Catalog Number | orb1303382 |
|---|---|
| Category | Small Molecules |
| Description | Vitexin-4''-O-glucoside |
| CAS Number | 178468-00-3 |
| Purity | 98.58% |
| MW | 594.52 |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@H]([C@H](O)[C@H]2O)c2c(O)cc(O)c3c2oc(cc3=O)-c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| Formula | C27H30O15 |
| Biological Activity | Vitexin-4''-O-glucoside (Vitexin -4''-O-glucoside) could effectively protect ECV-304 cells against cytotoxicity induced by TBHP through resuming mitochondrial function. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
