You have no items in your shopping cart.
Cart summary
UPF 1069
Catalog Number: orb1301004
| Catalog Number | orb1301004 |
|---|---|
| Category | Small Molecules |
| Description | UPF 1069 |
| CAS Number | 1048371-03-4 |
| Purity | 98.84% |
| MW | 279.29 |
| SMILES | O=C(COc1cccc2c1cc[nH]c2=O)c1ccccc1 |
| Formula | C17H13NO3 |
| Biological Activity | UPF 1069 is a specific PARP2 inhibitor ( IC50: 0.3 μM). It is ~27-fold selective against PARP1. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
