You have no items in your shopping cart.
Cart summary
TRPM8 antagonist 3
Catalog Number: orb1297931
| Catalog Number | orb1297931 |
|---|---|
| Category | Small Molecules |
| Description | TRPM8 antagonist 3 |
| CAS Number | 2102179-29-1 |
| Purity | 99.25% |
| MW | 292.31 |
| SMILES | Oc1nc(sc1C(=O)N1CCCO1)-c1ccccc1O |
| Formula | C13H12N2O4S |
| Biological Activity | TRPM8 antagonist 3 is a blocker of TRPM8 (IC50 = 11 nM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
