You have no items in your shopping cart.
Cart summary
Tos-PEG4-t-butyl ester
Catalog Number: orb1909254
| Catalog Number | orb1909254 |
|---|---|
| Category | Small Molecules |
| Description | Tos-PEG4-t-butyl ester (Tos-PEG4-Boc) is a PROTAC linker characterized by its PEG composition, crucial in synthesizing various PROTACs, including BI-3663, a selective PTK2/FAK PROTAC. Using cereblon ligands, it targets E3 ligases to degrade PTK2, exhibiting potent inhibitory activity with an IC50 of 18 nM[1]. |
| CAS Number | 217817-01-1 |
| Purity | 98.00% |
| MW | 432.53 |
| SMILES | S(OCCOCCOCCOCCC(OC(C)(C)C)=O)(=O)(=O)C1=CC=C(C)C=C1 |
| Formula | C20H32O8S |
| Biological Activity | Tos-PEG4-t-butyl ester (Tos-PEG4-Boc) is a PROTAC linker characterized by its PEG composition. This compound plays a crucial role in the synthesis of a range of PROTACs, including BI-3663, a highly selective PTK2/FAK PROTAC. It employs cereblon ligands to target E3 ligases for the degradation of PTK2, exhibiting potent inhibitory activity with an IC50 of 18 nM[1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
