You have no items in your shopping cart.
Cart summary
| Catalog Number | orb1309516 |
|---|---|
| Category | Small Molecules |
| Description | Topotecan hydrochloride |
| CAS Number | 119413-54-6 |
| Purity | 98.76% |
| MW | 457.92 |
| SMILES | Cl.CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccc(O)c(CN(C)C)c4cc3Cn1c2=O |
| Formula | C23H24ClN3O5 |
| Biological Activity | Topotecan hydrochloride (NSC609699) is an antineoplastic agent used to treat ovarian cancer. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
