You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611462 |
---|---|
Category | Small Molecules |
Description | A potent, small molecule fetal hemoglobin (HbF) inducer with EC50 of 100 nM. |
CAS Number | [289479-94-3] |
MW | 509.6021 |
SMILES | O=C(C#CC1C=CC(C)=CC=1)NC1C=C(NC2N=C(NC3CCC(O)CC3)N=C3C=2N=CN3CC)C=CC=1 |
Formula | C29H31N7O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P | |
Mouse, Rat | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
ELISA, IHC, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P | |
Bovine, Canine, Equine, Mouse, Porcine, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Human, Porcine, Rabbit, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |