You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134754 |
---|---|
Category | Small Molecules |
Description | Tiotropium Bromide is a muscarinic acetylcholine receptor (mAChR M) antagonist that blocks the binding of the acetylcholine ligand and subsequent opening of the ligand-gated ion channel. This stops signaling between neurons and leads to muscle relaxation. |
CAS Number | [136310-93-5] |
MW | 472.42 |
SMILES | O=C(C(C1=CC=CS1)(O)C2=CC=CS2)O[C@H]3C[C@H]([N+]4(C)C)[C@@H]5O[C@@H]5[C@H]4C3.[Br-] |
Formula | C19H22NO4S2 Br |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[139404-48-1] | |
490.43 | |
C19H22NO4S2.Br.xH2O |
99.02% | |
411207-31-3 | |
490.43 | |
C19H24BrNO5S2 |
99.09% | |
136310-93-5 | |
472.42 | |
C19H22BrNO4S2 |
Filter by Rating