You have no items in your shopping cart.
Cart summary
Thalidomide-5-NH-PEG2-NH2 hydrochloride
Catalog Number: orb2300269
| Catalog Number | orb2300269 |
|---|---|
| Category | Small Molecules |
| Description | Thalidomide-5-NH-PEG2-NH2 hydrochloride is a cereblon ligand based on Thalidomide, designed to recruit CRBN proteins. It has the capability to be linked with target protein ligands via a linker, facilitating the formation of PROTAC molecules, such as THAL-SNS-032. |
| CAS Number | 2357110-58-6 |
| Purity | 98.00% |
| MW | 440.88 |
| SMILES | O=C1N(C(=O)C=2C1=CC(NCCOCCOCCN)=CC2)C3C(=O)NC(=O)CC3.Cl |
| Formula | C19H25ClN4O6 |
| Biological Activity | Thalidomide-5-NH-PEG2-NH2 hydrochloride is a cereblon ligand based on Thalidomide, designed to recruit CRBN proteins. It has the capability to be linked with target protein ligands via a linker, facilitating the formation of PROTAC molecules, such as THAL-SNS-032. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
