You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307672 |
---|---|
Category | Small Molecules |
Description | THAL-SNS-032 |
CAS Number | 2139287-33-3 |
Purity | 99.68% |
MW | 869.02 |
SMILES | O=C1C=2C(C(=O)N1C3C(=O)NC(=O)CC3)=CC=CC2NCCOCCOCCOCCNC(CN4CCC(C(NC=5SC(SCC=6OC(C(C)(C)C)=CN6)=CN5)=O)CC4)=O |
Formula | C40H52N8O10S2 |
Biological Activity | THAL-SNS-032 is a selective CDK9 degrader PROTAC. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
2863635-01-0 | |
484.93 | |
C21H29ClN4O7 |
98.00% | |
2357110-58-6 | |
440.88 | |
C19H25ClN4O6 |
98.00% | |
2863634-98-2 | |
396.83 | |
C17H21ClN4O5 |
[2139287-33-3] | |
869.022 | |
C40H52N8O10S2 |