You have no items in your shopping cart.
Cart summary
tert-Butyl5-bromo-1H-indole-1-carboxylate
Catalog Number: orb1744035
| Catalog Number | orb1744035 |
|---|---|
| Category | Small Molecules |
| Description | Tert-Butyl5-bromo-1H-indole-1-carboxylate (N-Boc-5-bromoindole) is an indole derivative with therapeutic potential for pain, inflammation, and other conditions. |
| CAS Number | 182344-70-3 |
| Purity | 98.16% |
| MW | 296.16 |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CC(Br)=CC=C12 |
| Formula | C13H14BrNO2 |
| Biological Activity | Tert-Butyl5-bromo-1H-indole-1-carboxylate (N-Boc-5-bromoindole) is an indole derivative with therapeutic potential for pain, inflammation, and other conditions. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
