You have no items in your shopping cart.
Cart summary
Tenovin-3
Catalog Number: orb1307286
| Catalog Number | orb1307286 |
|---|---|
| Category | Small Molecules |
| Description | Tenovin-3 |
| CAS Number | 1011301-27-1 |
| Purity | 99.93% |
| MW | 327.44 |
| SMILES | CC(C)(C)c1ccc(cc1)C(=O)NC(=S)Nc1ccc(N)cc1 |
| Formula | C18H21N3OS |
| Biological Activity | Tenovin-3 acts as a p53 activator. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
