You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb341889 |
---|---|
Category | Small Molecules |
Description | Tenofovir(GS 1278, PMPA) is an antiretroviral drug known as nucleotide analogue reverse transcriptase inhibitors (NRTIs), which block reverse transcriptase, a crucial virus enzyme in HIV-1 and HBV. |
CAS Number | [147127-20-6] |
MW | 287.2158 |
SMILES | C[C@@H](CN1C=NC2=C(N=CN=C12)N)OCP(=O)(O)O |
Formula | C9H14N5O4P |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Tenofovir
[202138-50-9] | |
635.5198 | |
C23H34N5O14P |
98% | |
1571076-26-0 | |
490.501 | |
C22H31N6O5P |