You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb146182 |
---|---|
Category | Small Molecules |
Description | Tenofovir disoproxil fumarate belongs to nucleotide analogue reverse transcriptase inhibitors (nRTIs). |
CAS Number | [202138-50-9] |
MW | 635.5198 |
SMILES | O=C(OC(C)C)OCOP(OCOC(OC(C)C)=O)(CO[C@H](C)CN1C=NC2=C(N)N=CN=C12)=O.O=C(O)/C=C/C(O)=O |
Formula | C23H34N5O14P |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Tenofovir disoproxil fumarate
[1392275-56-7] | |
1069.00408 | |
2[C21H29N6O5P].C4H4O4 |
> 98%,Standard References | |
[1464851-21-5] | |
175.19 | |
C8H9N5 |
99.86% | |
202138-50-9 | |
635.51 | |
C19H30N5O10P·C4H4O4 |