You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb691978 |
---|---|
Category | Small Molecules |
Description | Torezolid (TR-701; tedizolid) is a novel oxazolidinone for gram-positive infections. |
CAS Number | [856866-72-3] |
MW | 370.34 |
SMILES | O=C1O[C@@H](CO)CN1C2=CC=C(C3=CC=C(C4=NN(C)N=N4)N=C3)C(F)=C2 |
Formula | C17H15FN6O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.37% | |
856866-72-3 | |
370.34 | |
C17H15FN6O3 |
98% | |
856867-39-5 | |
496.303 | |
C17H16FN6Na2O6P |