You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573018 |
---|---|
Category | Small Molecules |
Description | Tafamidis is a novel specific transthyretin (TTR) stabilizer or dissociation inhibitor. |
CAS Number | [951395-08-7] |
MW | 503.33 |
SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CNC.O=C(C1=CC=C2N=C(C3=CC(Cl)=CC(Cl)=C3)OC2=C1)O |
Formula | C21H24Cl2N2O8 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.98% | |
951395-08-7 | |
503.33 | |
C21H24Cl2N2O8 |