You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525597 |
---|---|
Category | Small Molecules |
Description | Syk inhibitor II is a cell-permeable, pyrimidine-carboxamide compound that selectively and reversibly blocks Syk (IC50 = 41 nM) in an ATP-competitive manner. |
CAS Number | [726695-51-8] |
MW | 340.3 |
SMILES | O=C(C1=CN=C(NCCN)N=C1NC2=CC=CC(C(F)(F)F)=C2)N |
Formula | C14H15F3N6O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
1965323-05-0 | |
449.26 | |
C14H21Cl2F3N6O3 |
> 98% (HPLC) | |
227449-73-2 | |
413.2 | |
C14H17Cl2F3N6O |
99.59% | |
227449-73-2 | |
413.22 | |
C14H17Cl2F3N6O |
98% | |
2490508-82-0 | |
376.77 | |
C14H16ClF3N6O |