You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1302930 |
---|---|
Category | Small Molecules |
Description | Syk Inhibitor II |
CAS Number | 726695-51-8 |
Purity | 98.52% |
MW | 340.3 |
SMILES | NCCNc1ncc(C(N)=O)c(Nc2cccc(c2)C(F)(F)F)n1 |
Formula | C14H15F3N6O |
Biological Activity | Syk inhibitor II, a cell-permeable, ATP-competitive, pyrimidine-carboxamide compound, selectively and reversibly inhibits Syk (IC50 = 41 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
1965323-05-0 | |
449.26 | |
C14H21Cl2F3N6O3 |
> 98% (HPLC) | |
227449-73-2 | |
413.2 | |
C14H17Cl2F3N6O |
99.59% | |
227449-73-2 | |
413.22 | |
C14H17Cl2F3N6O |
98% | |
2490508-82-0 | |
376.77 | |
C14H16ClF3N6O |