You have no items in your shopping cart.
Cart summary
Sterebin F
Catalog Number: orb1943671
| Catalog Number | orb1943671 |
|---|---|
| Category | Small Molecules |
| Description | Sterebin F, a steroidal compound extracted from Stevia rebaudiana leaves, exhibits hypoglycemic activity [1]. |
| CAS Number | 114489-87-1 |
| Purity | 98.00% |
| MW | 338.48 |
| SMILES | C[C@]12[C@@]([C@@H](O)[C@H](O)[C@@](C)(O)[C@@H]1/C=C/C(=C\CO)/C)(C(C)(C)CCC2)[H] |
| Formula | C20H34O4 |
| Biological Activity | Sterebin F, a steroidal compound extracted from Stevia rebaudiana leaves, exhibits hypoglycemic activity [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
