You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611425 |
---|---|
Category | Small Molecules |
Description | Sincalide (CCK-8) is a 8-amino acid C-terminal fragment of cholecystokinin. |
CAS Number | [25126-32-3] |
MW | 1143.269 |
SMILES | CSCC[C@H](NC([C@H](CC1=CC=C(OS(=O)(O)=O)C=C1)NC([C@H](CC(=O)O)N)=O)=O)C(NCC(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@H](C(N[C@H](C(N[C@@H](CC1=CC=CC=C1)C(=O)N)=O)CC(=O)O)=O)CCSC)=O)=O)=O |
Formula | C49H62N10O16S3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Guinea pig | |
15.63-1000 pg/mL | |
5.31 pg/mL |
Rat | |
15.63-1000 pg/mL | |
5.35 pg/mL |
Mouse | |
15.63-1000 pg/mL | |
4.71 pg/mL |
Human | |
15.63-1000 pg/mL | |
4.46 pg/mL |