You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134790 |
---|---|
Category | Small Molecules |
Description | Silodosin(Rapaflo) is an α1-adrenoceptor antagonist with high uroselectivity. Silodosin causes practically no orthostatic hypotension (in contrast to other α1 blockers). Since Silodosin is a highly selective inhibitor of the α1A adrenergic receptor, it ca |
CAS Number | [160970-54-7] |
MW | 495.53 |
SMILES | NC(C1=C(N(CCCO)CC2)C2=CC(C[C@@H](C)NCCOC3=C(OCC(F)(F)F)C=CC=C3)=C1)=O |
Formula | C25H32F3N3O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Silodosin
99.65% | |
239463-85-5 | |
513.54 | |
C26H31N3O8 |
99.63% | |
160970-54-7 | |
495.53 | |
C25H32F3N3O4 |