You have no items in your shopping cart.
Cart summary
Schisantherin B
Catalog Number: orb1300178
| Catalog Number | orb1300178 |
|---|---|
| Category | Small Molecules |
| Description | Schisantherin B |
| CAS Number | 58546-55-7 |
| Purity | 99.06% |
| MW | 514.56 |
| SMILES | COC1=C2OCOC2=CC2=C[C@H](C)[C@](C)(O)[C@@H](OC(=O)C(\C)=C/C)c3cc(OC)c(OC)c(OC)c3[C@@H]12 |
| Formula | C28H34O9 |
| Biological Activity | 1. Schisantherin B (Schizantherin-B) shows good effect in lowering the serum glutamic-pyruvic transaminase level of the patients suffering from chronic virus hepatitis. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
