You have no items in your shopping cart.
Cart summary
Sanguinarine chloride
Catalog Number: orb1310909
| Catalog Number | orb1310909 |
|---|---|
| Category | Small Molecules |
| Description | Sanguinarine chloride |
| CAS Number | 5578-73-4 |
| Purity | 99.41% |
| MW | 367.78 |
| SMILES | [Cl-].C[n+]1cc2c3OCOc3ccc2c2ccc3cc4OCOc4cc3c12 |
| Formula | C20H14ClNO4 |
| Biological Activity | Sanguinarine chloride (Pseudochelerythrine chloride), a benzophenanthridine alkaloid, stimulates apoptosis by activating the production of reactive oxygen species (ROS). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
Sanguinarine citrate [orb1941136]
98.03%
2098782-69-3
523.45
C26H21NO11
1 mg, 5 mg, 10 mg, 25 mg, 50 mg, 100 mg, 500 mg
