You have no items in your shopping cart.
Cart summary
(S)-Alogliptin Benzoate Salt-13C-d3
Catalog Number: orb2281081
| Catalog Number | orb2281081 |
|---|---|
| Category | Small Molecules |
| Description | (S)-Alogliptin Benzoate Salt-13C-d3 is the 13C and deuterated compound of (S)-Alogliptin Benzoate Salt. |
| Purity | 98.00% |
| MW | 465.52 |
| SMILES | O=C(N(CC1=CC=CC=C1C#N)C(N2CCC[C@@H](N)C2)=C3)N([13C]([2H])([2H])[2H])C3=O.O=C(O)C4=CC=CC=C4 |
| Formula | 13C C24H24D3N5O4 |
| Biological Activity | (S)-Alogliptin Benzoate Salt-13C-d3 is the 13C and deuterated compound of (S)-Alogliptin Benzoate Salt. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
