You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611514 |
---|---|
Category | Small Molecules |
Description | A non-selective agonist of the dopamine D3 receptor (Ki=0.71 nM). |
CAS Number | [99755-59-6] |
MW | 315.4729 |
SMILES | CCCN([C@H]1CCC2C(=CC=CC=2C1)O)CCC1=CC=CS1 |
Formula | C19H25NOS |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.76% | |
99755-59-6 | |
315.47 | |
C19H25NOS |
99.66% | |
125572-93-2 | |
351.93 | |
C19H26ClNOS |
99.73% | |
92206-54-7 | |
315.47 | |
C19H25NOS |