You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1685305 |
---|---|
Category | Small Molecules |
Description | Rotigotine |
CAS Number | 92206-54-7 |
Purity | 99.73% |
MW | 315.47 |
SMILES | OC1=C2C(CC(N(CCC3=CC=CS3)CCC)CC2)=CC=C1 |
Formula | C19H25NOS |
Biological Activity | Rotigotine (1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-) is an antiparkinson agent and dopamine receptor agonist. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.76% | |
99755-59-6 | |
315.47 | |
C19H25NOS |
99.66% | |
125572-93-2 | |
351.93 | |
C19H26ClNOS |