You have no items in your shopping cart.
Cart summary
Rotigotine D7 Hydrochloride
Catalog Number: orb1990400
| Catalog Number | orb1990400 |
|---|---|
| Category | Small Molecules |
| Description | Rotigotine D7 Hydrochloride is the deuterium labeled Rotigotine(N-0923), which is an agonist of dopamine D2 and D3 receptor. |
| Purity | 98.00% |
| MW | 358.98 |
| SMILES | OC1=C(CC[C@H](N(C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])CCC2=CC=CS2)C3)C3=CC=C1.[H]Cl |
| Formula | C19H19D7ClNOS |
| Biological Activity | Rotigotine D7 Hydrochloride is the deuterium labeled Rotigotine(N-0923), which is an agonist of dopamine D2 and D3 receptor. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
