You have no items in your shopping cart.
Cart summary
RKI-1447 dihydrochloride
Catalog Number: orb1688133
| Catalog Number | orb1688133 |
|---|---|
| Category | Small Molecules |
| Description | RKI-1447 dihydrochloride |
| CAS Number | 1782109-09-4 |
| Purity | 98% |
| MW | 399.29 |
| SMILES | O=C(NCC1=CC(O)=CC=C1)NC2=NC(C3=CC=NC=C3)=CS2.Cl.Cl |
| Formula | C16H16Cl2N4O2S |
| Biological Activity | RKI 1447 dihydrochloride is an effective and selective ROCK inhibitor (ROCK1 IC50=14.5 nM, ROCK2 IC50=6.2 nM). RKI 1447 dihydrochloride can inhibit the growth of colorectal cancer cells and promote cell apoptosis. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
