You have no items in your shopping cart.
Cart summary
Rheumone B
Catalog Number: orb1680091
| Catalog Number | orb1680091 |
|---|---|
| Category | Small Molecules |
| Description | Rheumone B |
| CAS Number | 2095596-67-9 |
| Purity | 98% |
| MW | 448.42 |
| SMILES | O(C=1C2=C(C=C3C(=C2O)C(=O)OC=C(C)C3)C=C(OC)C1)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O |
| Formula | C22H24O10 |
| Biological Activity | Rheumone B is a natural product for research related to life sciences. The catalog number is orb1680091 and the CAS number is 2095596-67-9. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
