You have no items in your shopping cart.
Cart summary
rac Tenofovir-d6
Catalog Number: orb2281125
| Catalog Number | orb2281125 |
|---|---|
| Category | Small Molecules |
| Description | rac Tenofovir-d6 is a deuterated compound of rac Tenofovir. rac Tenofovir has a CAS number of 107021-12-5. |
| CAS Number | 1020719-94-1 |
| Purity | 98.00% |
| MW | 293.25 |
| SMILES | C(C(OCP(=O)(O)O)(C([2H])([2H])[2H])[2H])(N1C=2C(N=C1)=C(N)N=CN2)([2H])[2H] |
| Formula | C9H8D6N5O4P |
| Biological Activity | rac Tenofovir-d6 is a deuterated compound of rac Tenofovir. rac Tenofovir has a CAS number of 107021-12-5. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
