You have no items in your shopping cart.
Cart summary
(Rac)-Byakangelicin
Catalog Number: orb1692389
| Catalog Number | orb1692389 |
|---|---|
| Category | Small Molecules |
| Description | (Rac)-Byakangelicin |
| CAS Number | 19573-01-4 |
| Purity | 99.94% |
| MW | 334.32 |
| SMILES | COc1c2ccoc2c(OCC(O)C(C)(C)O)c2oc(=O)ccc12 |
| Formula | C17H18O7 |
| Biological Activity | (Rac)-Byakangelicin (7H-Furo[3,2-g][1]benzopyran-7-one, 9-(2,3-dihydroxy-3-methylbutoxy)-4-methoxy-) is an antineoplastic agent. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
