You have no items in your shopping cart.
Cart summary
Qianhucoumarin G
Catalog Number: orb1984168
| Catalog Number | orb1984168 |
|---|---|
| Category | Small Molecules |
| Description | Qianhucoumarin G is a natural product from Peucedanum praeruptorum. |
| CAS Number | 68692-61-5 |
| Purity | 98.00% |
| MW | 262.26 |
| SMILES | OC=1C2=C(C=C3C1O[C@@H](C(C)(C)O)C3)C=CC(=O)O2 |
| Formula | C14H14O5 |
| Biological Activity | Qianhucoumarin G is a natural product from Peucedanum praeruptorum. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
