You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2279062 |
---|---|
Category | Small Molecules |
Description | Py-MAA-Val-Cit-PAB-MMAE |
CAS Number | 2247398-68-9 |
MW | 1446.79 |
SMILES | [C@H]([C@H](C(N[C@@H]([C@@H](O)C1=CC=CC=C1)C)=O)C)(OC)[C@]2(N(C(C[C@H]([C@@H](N(C([C@@H](NC([C@@H](N(C(OCC3=CC=C(NC([C@@H](NC([C@@H](NC(CSCCC(=O)N4CN(C(C=C)=O)CN(C(C=C)=O)C4)=O)[C@H](C)C)=O)CCCNC(N)=O)=O)C=C3)=O)C)C(C)C)=O)[C@@H](C)C)=O)C)[C@H](CC)C)OC)=O)CCC2)[H] |
Formula | C72H111N13O16S |
Biological Activity | Py-MAA-Val-Cit-PAB-MMAE (AAJ8D6-PY-Val-Cit-MMAE) serves as an ADC linker for Zapadcine-3a, a broad-spectrum anti-TRAILR2 ADC with antineoplastic properties. By targeting TRAILR2, Zapadcine-3a is internalized into the lysosomes of tumor cells, where it subsequently releases a small molecular compound that selectively eradicates TRAILR2-positive tumor cells, potentially leading to tumor remission [1]. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Filter by Rating