You have no items in your shopping cart.
Cart summary
Propargyl-PEG4-CH2CH2-Boc
Catalog Number: orb1909287
| Catalog Number | orb1909287 |
|---|---|
| Category | Small Molecules |
| Description | Propargyl-PEG4-CH2CH2-Boc is a PEG- and Alkyl/ether-based non-cleavable ADC linker. Propargyl-PEG5-Boc can be used to synthesize ADC inhibitors of Galectin-3[1]. |
| CAS Number | 1245823-50-0 |
| Purity | 98.00% |
| MW | 360.44 |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCC#C |
| Formula | C18H32O7 |
| Biological Activity | Propargyl-PEG4-CH2CH2-Boc is a PEG- and Alkyl/ether-based non-cleavable ADC linker. Propargyl-PEG5-Boc can used to synthesize ADC inhibitors of Galectin-3[1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
