You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb154668 |
---|---|
Category | Small Molecules |
Description | Pramipexole is a partial/full D2S, D2L, D3, D4, receptor agonist with a Ki of 3.9, 2.2, 0.5, 5.1 nM. |
CAS Number | [104632-25-9] |
MW | 284.25 |
SMILES | NC(S1)=NC2=C1C[C@@H](NCCC)CC2.[H]Cl.[H]Cl |
Formula | C10H19Cl2N3S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Pramipexole dihydrochloride
≥98% | |
191217-81-9 | |
302.26 | |
C10H17N3S 2HCl H2O |
[191217-81-9] | |
302.2642391 | |
C10H21CL2N3OS |
98.00% | |
1217601-58-5 | |
289.28 | |
C10H14D5Cl2N3S |