You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb146210 |
---|---|
Category | Small Molecules |
Description | PP1 is a potent and selective Src inhibitor for Lck/Fyn with IC50 of 5 nM/ 6 nM. |
CAS Number | [172889-26-8] |
MW | 281.36 |
SMILES | CC1=CC=C(C=C1)C2=NN(C3=C2C(=NC=N3)N)C(C)(C)C |
Formula | C16H19N5 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, ICC, IF, IHC, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ELISA, IHC, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IHC-P, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
Filter by Rating