You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307465 |
---|---|
Category | Small Molecules |
Description | Plerixafor |
CAS Number | 110078-46-1 |
Purity | 99.81% |
MW | 502.78 |
SMILES | C(N1CCCNCCNCCCNCC1)c1ccc(CN2CCCNCCNCCCNCC2)cc1 |
Formula | C28H54N8 |
Biological Activity | Plerixafor (AMD-3329), a chemokine receptor antagonist, blocks the binding of stromal cell-derived factor (SDF-1alpha) to the cellular receptor CXCR4. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[155148-31-5] | |
794.46 | |
C28H62Cl8N8 |
99.96% | |
155148-31-5 | |
794.46 | |
C28H62Cl8N8 |