You have no items in your shopping cart.
Cart summary
Pinobanksin 3-(2-methyl)butyrate
Catalog Number: orb1681244
| Catalog Number | orb1681244 |
|---|---|
| Category | Small Molecules |
| Description | Pinobanksin 3-(2-methyl)butyrate |
| CAS Number | 1221923-43-8 |
| Purity | 98% |
| MW | 356.37 |
| SMILES | O(C(C(CC)C)=O)[C@@H]1[C@H](OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC=CC=C3 |
| Formula | C20H20O6 |
| Biological Activity | Pinobanksin 3-(2-methyl)butyrate is a Pinobanksin derivative. pinobanksin is a apoptosis inducer that can induce apoptosis of F6 cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
