You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105875 |
---|---|
Category | Small Molecules |
Description | Phytic acid |
CAS Number | [83-86-3] |
Purity | > 98%,Standard References |
MW | 660.04 |
SMILES | OP(O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O)(O)=O |
Formula | C6H18O24P6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
14306-25-3 | |
923.82 | |
C6H6Na12O24P6 |
90% | |
83-86-3 | |
660.04 | |
C6H18O24P6 |