You have no items in your shopping cart.
Cart summary
PF-06454589
Catalog Number: orb1299557
| Catalog Number | orb1299557 |
|---|---|
| Category | Small Molecules |
| Description | PF-06454589 |
| CAS Number | 1527473-30-8 |
| Purity | 96.29% |
| MW | 284.32 |
| SMILES | Cn1cc(cn1)-c1c[nH]c2ncnc(N3CCOCC3)c12 |
| Formula | C14H16N6O |
| Biological Activity | PF-06454589 is a potent inhibitor of LRRK2. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
