You have no items in your shopping cart.
Cart summary
(+)-Perillaldehyde
Catalog Number: orb1984138
| Catalog Number | orb1984138 |
|---|---|
| Category | Small Molecules |
| Description | (+)-Perillaldehyde is a natural product. |
| CAS Number | 5503-12-8 |
| Purity | 98.00% |
| MW | 150.22 |
| SMILES | C(C)(=C)[C@@H]1CCC(C=O)=CC1 |
| Formula | C10H14O |
| Biological Activity | (+)-Perillaldehyde is a natural product. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
