You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611439 |
---|---|
Category | Small Molecules |
Description | A potent, stable cyclohexapeptide somatostatin mimic that exhibits unique high-affinity binding to human somatostatin receptors (pKi=8.2/9.0/9.1/<7.0/9.9 for sst1/2/3/4/5, respectively). |
CAS Number | [396091-73-9] |
MW | 1047.206 |
SMILES | NCCCCC1NC(=O)C(CC2C3C=CC=CC=3NC=2)NC(=O)C(NC(=O)C2CC(OC(=O)NCCN)CN2C(=O)C(NC(=O)C(CC2C=CC(OCC3C=CC=CC=3)=CC=2)NC1=O)CC1C=CC=CC=1)C1C=CC=CC=1 |
Formula | C58H66N10O9 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
1421446-02-7 | |
1313.41 | |
C66H80N12O17 |
396091-79-5 | |
1435.58 | |
C81H82N10O15 |
> 98% (HPLC) | |
396091-76-2 |
Filter by Rating