You have no items in your shopping cart.
Cart summary
Pasireotide Acetate
Catalog Number: orb1296348
| Catalog Number | orb1296348 |
|---|---|
| Category | Small Molecules |
| Description | Pasireotide Acetate |
| CAS Number | 396091-76-2 |
| Purity | 99.92% |
| MW | 1107.26 |
| SMILES | CC(O)=O.NCCCC[C@@H]1NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](NC(=O)[C@@H]2C[C@H](CN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccc(OCc3ccccc3)cc2)NC1=O)OC(=O)NCCN)c1ccccc1 |
| Formula | C60H70N10O11 |
| Biological Activity | Pasireotide Acetate is a stable cyclohexapeptide somatostatin mimic |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
