You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308932 |
---|---|
Category | Small Molecules |
Description | Pamidronate Disodium |
CAS Number | 57248-88-1 |
Purity | 99.94% |
MW | 279.03 |
SMILES | [Na+].[Na+].NCCC(O)(P(O)([O-])=O)P(O)([O-])=O |
Formula | C3H9NNa2O7P2 |
Biological Activity | Pamidronate Disodium (CGP 23339A), a nitrogen-containing bisphosphonate, can help to strengthen bones. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥98% | |
109552-15-0 | |
369.11 | |
C3H9NNa2O7P2 5H2O |
98% | |
109552-15-0 | |
371.13 | |
C3H13NNaO8P2 |