You have no items in your shopping cart.
Cart summary
(+)-Oxypeucedanin methanolate
Catalog Number: orb1981820
| Catalog Number | orb1981820 |
|---|---|
| Category | Small Molecules |
| Description | (+)-Oxypeucedanin methanolate (compound 9) is a natural inhibitor of prostaglandin E2 production [1]. |
| CAS Number | 52939-12-5 |
| Purity | 98.00% |
| MW | 318.32 |
| SMILES | O(C[C@H](C(OC)(C)C)O)C=1C2=C(C=C3C1C=CO3)OC(=O)C=C2 |
| Formula | C17H18O6 |
| Biological Activity | (+)-Oxypeucedanin methanolate (compound 9) is a natural compound that inhibits prostaglandin E2 production [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
